C13H23F2NO — CID 156637319
3-(2,6-difluoroanilino)propan-1-ol;ethane (PubChem CID 156637319) has the molecular formula C13H23F2NO and a molecular weight of 247.33 g/mol. Its IUPAC name is 3-(2,6-difluoroanilino)propan-1-ol;ethane.
| Compound Name | 3-(2,6-difluoroanilino)propan-1-ol;ethane |
|---|---|
| PubChem CID | 156637319 |
| Molecular Formula | C13H23F2NO |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 3-(2,6-difluoroanilino)propan-1-ol;ethane |
| SMILES | CC.CC.OCCCNc1c(F)cccc1F |
| InChI | InChI=1S/C9H11F2NO.2C2H6/c10-7-3-1-4-8(11)9(7)12-5-2-6-13;2*1-2/h1,3-4,12-13H,2,5-6H2;2*1-2H3 |
| InChIKey | RFCZIWJOEDDZKD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|