C16H17F2N — CID 114333174
2,6-difluoro-N-(4-phenylbutyl)aniline (PubChem CID 114333174) has the molecular formula C16H17F2N and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,6-difluoro-N-(4-phenylbutyl)aniline.
| Compound Name | 2,6-difluoro-N-(4-phenylbutyl)aniline |
|---|---|
| PubChem CID | 114333174 |
| Molecular Formula | C16H17F2N |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2,6-difluoro-N-(4-phenylbutyl)aniline |
| SMILES | Fc1cccc(F)c1NCCCCc1ccccc1 |
| InChI | InChI=1S/C16H17F2N/c17-14-10-6-11-15(18)16(14)19-12-5-4-9-13-7-2-1-3-8-13/h1-3,6-8,10-11,19H,4-5,9,12H2 |
| InChIKey | OOWZQUYWFCHPEO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|