C16H15F2NO2 — CID 63187020
3,5-difluoro-4-(3-phenylpropylamino)benzoic acid (PubChem CID 63187020) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3,5-difluoro-4-(3-phenylpropylamino)benzoic acid.
| Compound Name | 3,5-difluoro-4-(3-phenylpropylamino)benzoic acid |
|---|---|
| PubChem CID | 63187020 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3,5-difluoro-4-(3-phenylpropylamino)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(NCCCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C16H15F2NO2/c17-13-9-12(16(20)21)10-14(18)15(13)19-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10,19H,4,7-8H2,(H,20,21) |
| InChIKey | DMIOGMFHGGNZQE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|