C13H12F2N2 — CID 55169588
2,6-difluoro-N-(2-pyridin-3-ylethyl)aniline (PubChem CID 55169588) has the molecular formula C13H12F2N2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-pyridin-3-ylethyl)aniline.
| Compound Name | 2,6-difluoro-N-(2-pyridin-3-ylethyl)aniline |
|---|---|
| PubChem CID | 55169588 |
| Molecular Formula | C13H12F2N2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2,6-difluoro-N-(2-pyridin-3-ylethyl)aniline |
| SMILES | Fc1cccc(F)c1NCCc1cccnc1 |
| InChI | InChI=1S/C13H12F2N2/c14-11-4-1-5-12(15)13(11)17-8-6-10-3-2-7-16-9-10/h1-5,7,9,17H,6,8H2 |
| InChIKey | NGAMOTZUCVLJOP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |