C11H13ClN2S — CID 106426181
2-chloro-1-N-(2-prop-2-ynylsulfanylethyl)benzene-1,4-diamine (PubChem CID 106426181) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is 2-chloro-1-N-(2-prop-2-ynylsulfanylethyl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-(2-prop-2-ynylsulfanylethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106426181 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-chloro-1-N-(2-prop-2-ynylsulfanylethyl)benzene-1,4-diamine |
| SMILES | C#CCSCCNc1ccc(N)cc1Cl |
| InChI | InChI=1S/C11H13ClN2S/c1-2-6-15-7-5-14-11-4-3-9(13)8-10(11)12/h1,3-4,8,14H,5-7,13H2 |
| InChIKey | IUAZFENYMBKREZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|