C12H13ClN2OS — CID 106425242
4-amino-3-chloro-N-(2-prop-2-ynylsulfanylethyl)benzamide (PubChem CID 106425242) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(2-prop-2-ynylsulfanylethyl)benzamide.
| Compound Name | 4-amino-3-chloro-N-(2-prop-2-ynylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 106425242 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 4-amino-3-chloro-N-(2-prop-2-ynylsulfanylethyl)benzamide |
| SMILES | C#CCSCCNC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2OS/c1-2-6-17-7-5-15-12(16)9-3-4-11(14)10(13)8-9/h1,3-4,8H,5-7,14H2,(H,15,16) |
| InChIKey | GGOVDWZSGCHMAR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|