C16H14BrNOS — CID 103824835
6-bromo-N-(2-prop-2-ynylsulfanylethyl)naphthalene-2-carboxamide (PubChem CID 103824835) has the molecular formula C16H14BrNOS and a molecular weight of 348.27 g/mol. Its IUPAC name is 6-bromo-N-(2-prop-2-ynylsulfanylethyl)naphthalene-2-carboxamide.
| Compound Name | 6-bromo-N-(2-prop-2-ynylsulfanylethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 103824835 |
| Molecular Formula | C16H14BrNOS |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 6-bromo-N-(2-prop-2-ynylsulfanylethyl)naphthalene-2-carboxamide |
| SMILES | C#CCSCCNC(=O)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C16H14BrNOS/c1-2-8-20-9-7-18-16(19)14-4-3-13-11-15(17)6-5-12(13)10-14/h1,3-6,10-11H,7-9H2,(H,18,19) |
| InChIKey | TZDXFKGSLGBISN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|