C12H14N2O3S2 — CID 113240176
N-(2-prop-2-ynylsulfanylethyl)-3-sulfamoylbenzamide (PubChem CID 113240176) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(2-prop-2-ynylsulfanylethyl)-3-sulfamoylbenzamide.
| Compound Name | N-(2-prop-2-ynylsulfanylethyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 113240176 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | N-(2-prop-2-ynylsulfanylethyl)-3-sulfamoylbenzamide |
| SMILES | C#CCSCCNC(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H14N2O3S2/c1-2-7-18-8-6-14-12(15)10-4-3-5-11(9-10)19(13,16)17/h1,3-5,9H,6-8H2,(H,14,15)(H2,13,16,17) |
| InChIKey | POWUEMYOXGAQLW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|