C18H22N2O3S2 — CID 32965738
N-(2-benzylsulfanylethyl)-3-(ethylsulfamoyl)benzamide (PubChem CID 32965738) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-3-(ethylsulfamoyl)benzamide.
| Compound Name | N-(2-benzylsulfanylethyl)-3-(ethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 32965738 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-3-(ethylsulfamoyl)benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)NCCSCc2ccccc2)c1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-2-20-25(22,23)17-10-6-9-16(13-17)18(21)19-11-12-24-14-15-7-4-3-5-8-15/h3-10,13,20H,2,11-12,14H2,1H3,(H,19,21) |
| InChIKey | OAIAOFLAWPQYFD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|