C22H30N4O3S — CID 33134557
3-(ethylsulfamoyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 33134557) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is 3-(ethylsulfamoyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 3-(ethylsulfamoyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 33134557 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-(ethylsulfamoyl)-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)NCCCN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H30N4O3S/c1-2-24-30(28,29)21-11-6-8-19(18-21)22(27)23-12-7-13-25-14-16-26(17-15-25)20-9-4-3-5-10-20/h3-6,8-11,18,24H,2,7,12-17H2,1H3,(H,23,27) |
| InChIKey | OHEAGJVZSJTWRS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|