C13H14ClNO3S2 — CID 106428451
3-methyl-5-(2-prop-2-ynylsulfanylethylcarbamoyl)benzenesulfonyl chloride (PubChem CID 106428451) has the molecular formula C13H14ClNO3S2 and a molecular weight of 331.85 g/mol. Its IUPAC name is 3-methyl-5-(2-prop-2-ynylsulfanylethylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 3-methyl-5-(2-prop-2-ynylsulfanylethylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 106428451 |
| Molecular Formula | C13H14ClNO3S2 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 3-methyl-5-(2-prop-2-ynylsulfanylethylcarbamoyl)benzenesulfonyl chloride |
| SMILES | C#CCSCCNC(=O)c1cc(C)cc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H14ClNO3S2/c1-3-5-19-6-4-15-13(16)11-7-10(2)8-12(9-11)20(14,17)18/h1,7-9H,4-6H2,2H3,(H,15,16) |
| InChIKey | VFBMXKJMKQWXRZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|