C14H14N2O2S — CID 102737406
2-oxo-N-(2-prop-2-ynylsulfanylethyl)-1,3-dihydroindole-6-carboxamide (PubChem CID 102737406) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-oxo-N-(2-prop-2-ynylsulfanylethyl)-1,3-dihydroindole-6-carboxamide.
| Compound Name | 2-oxo-N-(2-prop-2-ynylsulfanylethyl)-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102737406 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-oxo-N-(2-prop-2-ynylsulfanylethyl)-1,3-dihydroindole-6-carboxamide |
| SMILES | C#CCSCCNC(=O)c1ccc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C14H14N2O2S/c1-2-6-19-7-5-15-14(18)11-4-3-10-9-13(17)16-12(10)8-11/h1,3-4,8H,5-7,9H2,(H,15,18)(H,16,17) |
| InChIKey | UKLULPFEVHJJGH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|