C13H14ClN3O — CID 114182714
4-amino-3-chloro-N-(2-pyrrol-1-ylethyl)benzamide (PubChem CID 114182714) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(2-pyrrol-1-ylethyl)benzamide.
| Compound Name | 4-amino-3-chloro-N-(2-pyrrol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 114182714 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-amino-3-chloro-N-(2-pyrrol-1-ylethyl)benzamide |
| SMILES | Nc1ccc(C(=O)NCCn2cccc2)cc1Cl |
| InChI | InChI=1S/C13H14ClN3O/c14-11-9-10(3-4-12(11)15)13(18)16-5-8-17-6-1-2-7-17/h1-4,6-7,9H,5,8,15H2,(H,16,18) |
| InChIKey | JGBARIYWTLFPLF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|