C10H16N2S — CID 63981409
2-N-(3-methylsulfanylpropyl)benzene-1,2-diamine (PubChem CID 63981409) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 2-N-(3-methylsulfanylpropyl)benzene-1,2-diamine.
| Compound Name | 2-N-(3-methylsulfanylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63981409 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-N-(3-methylsulfanylpropyl)benzene-1,2-diamine |
| SMILES | CSCCCNc1ccccc1N |
| InChI | InChI=1S/C10H16N2S/c1-13-8-4-7-12-10-6-3-2-5-9(10)11/h2-3,5-6,12H,4,7-8,11H2,1H3 |
| InChIKey | JVYKAPYSLHXGBM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|