C12H14N4S3 — CID 106434248
4-(4-methyl-1,3-thiazol-2-yl)-5-N-(2-prop-2-ynylsulfanylethyl)-1,2-thiazole-3,5-diamine (PubChem CID 106434248) has the molecular formula C12H14N4S3 and a molecular weight of 310.47 g/mol. Its IUPAC name is 4-(4-methyl-1,3-thiazol-2-yl)-5-N-(2-prop-2-ynylsulfanylethyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-(4-methyl-1,3-thiazol-2-yl)-5-N-(2-prop-2-ynylsulfanylethyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 106434248 |
| Molecular Formula | C12H14N4S3 |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-(4-methyl-1,3-thiazol-2-yl)-5-N-(2-prop-2-ynylsulfanylethyl)-1,2-thiazole-3,5-diamine |
| SMILES | C#CCSCCNc1snc(N)c1-c1nc(C)cs1 |
| InChI | InChI=1S/C12H14N4S3/c1-3-5-17-6-4-14-11-9(10(13)16-19-11)12-15-8(2)7-18-12/h1,7,14H,4-6H2,2H3,(H2,13,16) |
| InChIKey | MLJHSDJMJVKZBV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|