C12H18N4OS2 — CID 107324532
5-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]pentan-1-ol (PubChem CID 107324532) has the molecular formula C12H18N4OS2 and a molecular weight of 298.44 g/mol. Its IUPAC name is 5-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]pentan-1-ol.
| Compound Name | 5-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107324532 |
| Molecular Formula | C12H18N4OS2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]pentan-1-ol |
| SMILES | Cc1csc(-c2c(N)nsc2NCCCCCO)n1 |
| InChI | InChI=1S/C12H18N4OS2/c1-8-7-18-12(15-8)9-10(13)16-19-11(9)14-5-3-2-4-6-17/h7,14,17H,2-6H2,1H3,(H2,13,16) |
| InChIKey | FKBOXSQCABYPOD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|