About 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol
3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol (PubChem CID 103349556) has the molecular formula C10H14N4OS2
and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol |
| PubChem CID | 103349556 |
| Molecular Formula | C10H14N4OS2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol |
| SMILES | Cc1csc(-c2c(N)nsc2NCCCO)n1 |
| InChI | InChI=1S/C10H14N4OS2/c1-6-5-16-10(13-6)7-8(11)14-17-9(7)12-3-2-4-15/h5,12,15H,2-4H2,1H3,(H2,11,14) |
| InChIKey | GHFAYWVNBJZJEC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol?
The IUPAC name of 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol (CID 103349556) is 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol.
What is the SMILES notation for 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol?
The canonical SMILES for 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol is Cc1csc(-c2c(N)nsc2NCCCO)n1.
What is the InChIKey of 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol?
The InChIKey is GHFAYWVNBJZJEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4OS2/c1-6-5-16-10(13-6)7-8(11)14-17-9(7)12-3-2-4-15/h5,12,15H,2-4H2,1H3,(H2,11,14).
What are the key properties of 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol?
3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol has a molecular weight of 270.38 g/mol, XLogP of 1.95, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]amino]propan-1-ol is sourced from PubChem (CID 103349556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).