C10H13N3O2S2 — CID 106434242
methyl 3-amino-5-(2-prop-2-ynylsulfanylethylamino)-1,2-thiazole-4-carboxylate (PubChem CID 106434242) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is methyl 3-amino-5-(2-prop-2-ynylsulfanylethylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | methyl 3-amino-5-(2-prop-2-ynylsulfanylethylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106434242 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | methyl 3-amino-5-(2-prop-2-ynylsulfanylethylamino)-1,2-thiazole-4-carboxylate |
| SMILES | C#CCSCCNc1snc(N)c1C(=O)OC |
| InChI | InChI=1S/C10H13N3O2S2/c1-3-5-16-6-4-12-9-7(10(14)15-2)8(11)13-17-9/h1,12H,4-6H2,2H3,(H2,11,13) |
| InChIKey | MGDBHMVQFJIPMM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|