C8H13N3O3S — CID 103382712
methyl 3-amino-5-(3-hydroxypropylamino)-1,2-thiazole-4-carboxylate (PubChem CID 103382712) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is methyl 3-amino-5-(3-hydroxypropylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | methyl 3-amino-5-(3-hydroxypropylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103382712 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | methyl 3-amino-5-(3-hydroxypropylamino)-1,2-thiazole-4-carboxylate |
| SMILES | COC(=O)c1c(N)nsc1NCCCO |
| InChI | InChI=1S/C8H13N3O3S/c1-14-8(13)5-6(9)11-15-7(5)10-3-2-4-12/h10,12H,2-4H2,1H3,(H2,9,11) |
| InChIKey | QKBIWFYGCXRNIV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|