C8H14N4O2S — CID 103382715
3-amino-5-(3-hydroxypropylamino)-N-methyl-1,2-thiazole-4-carboxamide (PubChem CID 103382715) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-amino-5-(3-hydroxypropylamino)-N-methyl-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-5-(3-hydroxypropylamino)-N-methyl-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103382715 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-amino-5-(3-hydroxypropylamino)-N-methyl-1,2-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1c(N)nsc1NCCCO |
| InChI | InChI=1S/C8H14N4O2S/c1-10-7(14)5-6(9)12-15-8(5)11-3-2-4-13/h11,13H,2-4H2,1H3,(H2,9,12)(H,10,14) |
| InChIKey | KQWKJGLCOBJCAV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|