C8H14N4O2S — CID 103382771
3-amino-5-(3-methoxypropylamino)-1,2-thiazole-4-carboxamide (PubChem CID 103382771) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-amino-5-(3-methoxypropylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-5-(3-methoxypropylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103382771 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-amino-5-(3-methoxypropylamino)-1,2-thiazole-4-carboxamide |
| SMILES | COCCCNc1snc(N)c1C(N)=O |
| InChI | InChI=1S/C8H14N4O2S/c1-14-4-2-3-11-8-5(7(10)13)6(9)12-15-8/h11H,2-4H2,1H3,(H2,9,12)(H2,10,13) |
| InChIKey | FQOXCSNYICRUOR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|