C7H12N4O2S — CID 103382889
3-amino-5-(2-hydroxypropylamino)-1,2-thiazole-4-carboxamide (PubChem CID 103382889) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 3-amino-5-(2-hydroxypropylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-5-(2-hydroxypropylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103382889 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-amino-5-(2-hydroxypropylamino)-1,2-thiazole-4-carboxamide |
| SMILES | CC(O)CNc1snc(N)c1C(N)=O |
| InChI | InChI=1S/C7H12N4O2S/c1-3(12)2-10-7-4(6(9)13)5(8)11-14-7/h3,10,12H,2H2,1H3,(H2,8,11)(H2,9,13) |
| InChIKey | XJHKSSPYIAVBIU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |