C9H16N4OS — CID 103380049
3-amino-5-(2-methylbutylamino)-1,2-thiazole-4-carboxamide (PubChem CID 103380049) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-amino-5-(2-methylbutylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-5-(2-methylbutylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103380049 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-amino-5-(2-methylbutylamino)-1,2-thiazole-4-carboxamide |
| SMILES | CCC(C)CNc1snc(N)c1C(N)=O |
| InChI | InChI=1S/C9H16N4OS/c1-3-5(2)4-12-9-6(8(11)14)7(10)13-15-9/h5,12H,3-4H2,1-2H3,(H2,10,13)(H2,11,14) |
| InChIKey | CDWIPWDTLCIUAL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |