C6H11N5OS — CID 103383737
3-amino-5-(2,2-dimethylhydrazinyl)-1,2-thiazole-4-carboxamide (PubChem CID 103383737) has the molecular formula C6H11N5OS and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-amino-5-(2,2-dimethylhydrazinyl)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-5-(2,2-dimethylhydrazinyl)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103383737 |
| Molecular Formula | C6H11N5OS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 3-amino-5-(2,2-dimethylhydrazinyl)-1,2-thiazole-4-carboxamide |
| SMILES | CN(C)Nc1snc(N)c1C(N)=O |
| InChI | InChI=1S/C6H11N5OS/c1-11(2)9-6-3(5(8)12)4(7)10-13-6/h9H,1-2H3,(H2,7,10)(H2,8,12) |
| InChIKey | OLVBOKAHIOVXRW-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|