C6H12N4S — CID 103364838
5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine (PubChem CID 103364838) has the molecular formula C6H12N4S and a molecular weight of 172.26 g/mol. Its IUPAC name is 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine.
| Compound Name | 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103364838 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine |
| SMILES | Cc1c(N)nsc1NN(C)C |
| InChI | InChI=1S/C6H12N4S/c1-4-5(7)9-11-6(4)8-10(2)3/h8H,1-3H3,(H2,7,9) |
| InChIKey | JNHTUEQYTDIRTH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|