About 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine
5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine (PubChem CID 103364838) has the molecular formula C6H12N4S
and a molecular weight of 172.26 g/mol. Its IUPAC name is 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine.
Molecular Properties
| Compound Name | 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine |
| PubChem CID | 103364838 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine |
| SMILES | Cc1c(N)nsc1NN(C)C |
| InChI | InChI=1S/C6H12N4S/c1-4-5(7)9-11-6(4)8-10(2)3/h8H,1-3H3,(H2,7,9) |
| InChIKey | JNHTUEQYTDIRTH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine?
The IUPAC name of 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine (CID 103364838) is 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine.
What is the SMILES notation for 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine?
The canonical SMILES for 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine is Cc1c(N)nsc1NN(C)C.
What is the InChIKey of 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine?
The InChIKey is JNHTUEQYTDIRTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S/c1-4-5(7)9-11-6(4)8-10(2)3/h8H,1-3H3,(H2,7,9).
What are the key properties of 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine?
5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine has a molecular weight of 172.26 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylhydrazinyl)-4-methyl-1,2-thiazol-3-amine is sourced from PubChem (CID 103364838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).