C9H15N3S2 — CID 103365642
4-methyl-5-N-(thian-4-yl)-1,2-thiazole-3,5-diamine (PubChem CID 103365642) has the molecular formula C9H15N3S2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 4-methyl-5-N-(thian-4-yl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-methyl-5-N-(thian-4-yl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103365642 |
| Molecular Formula | C9H15N3S2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-methyl-5-N-(thian-4-yl)-1,2-thiazole-3,5-diamine |
| SMILES | Cc1c(N)nsc1NC1CCSCC1 |
| InChI | InChI=1S/C9H15N3S2/c1-6-8(10)12-14-9(6)11-7-2-4-13-5-3-7/h7,11H,2-5H2,1H3,(H2,10,12) |
| InChIKey | YFHFKOYMLVOKHI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |