C11H17N3S — CID 103363356
5-N-cyclopentyl-4-cyclopropyl-1,2-thiazole-3,5-diamine (PubChem CID 103363356) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 5-N-cyclopentyl-4-cyclopropyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-cyclopentyl-4-cyclopropyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103363356 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 5-N-cyclopentyl-4-cyclopropyl-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NC2CCCC2)c1C1CC1 |
| InChI | InChI=1S/C11H17N3S/c12-10-9(7-5-6-7)11(15-14-10)13-8-3-1-2-4-8/h7-8,13H,1-6H2,(H2,12,14) |
| InChIKey | DEUNCEQQZCFILL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |