C11H19N3S — CID 103363365
4-cyclopropyl-5-N-pentan-3-yl-1,2-thiazole-3,5-diamine (PubChem CID 103363365) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 4-cyclopropyl-5-N-pentan-3-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 4-cyclopropyl-5-N-pentan-3-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103363365 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4-cyclopropyl-5-N-pentan-3-yl-1,2-thiazole-3,5-diamine |
| SMILES | CCC(CC)Nc1snc(N)c1C1CC1 |
| InChI | InChI=1S/C11H19N3S/c1-3-8(4-2)13-11-9(7-5-6-7)10(12)14-15-11/h7-8,13H,3-6H2,1-2H3,(H2,12,14) |
| InChIKey | JHFDCUBTIFPGFW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |