C14H23N3OS — CID 103361711
5-N-(2-cyclohexyloxyethyl)-4-cyclopropyl-1,2-thiazole-3,5-diamine (PubChem CID 103361711) has the molecular formula C14H23N3OS and a molecular weight of 281.43 g/mol. Its IUPAC name is 5-N-(2-cyclohexyloxyethyl)-4-cyclopropyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(2-cyclohexyloxyethyl)-4-cyclopropyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103361711 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 5-N-(2-cyclohexyloxyethyl)-4-cyclopropyl-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCCOC2CCCCC2)c1C1CC1 |
| InChI | InChI=1S/C14H23N3OS/c15-13-12(10-6-7-10)14(19-17-13)16-8-9-18-11-4-2-1-3-5-11/h10-11,16H,1-9H2,(H2,15,17) |
| InChIKey | CXARMDIMEFLZQT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|