C10H18N4OS — CID 66278347
5-N-(2-cyclohexyloxyethyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66278347) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 5-N-(2-cyclohexyloxyethyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(2-cyclohexyloxyethyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66278347 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 5-N-(2-cyclohexyloxyethyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NCCOC2CCCCC2)n1 |
| InChI | InChI=1S/C10H18N4OS/c11-9-13-10(16-14-9)12-6-7-15-8-4-2-1-3-5-8/h8H,1-7H2,(H3,11,12,13,14) |
| InChIKey | VHNXQDNUUUGARV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|