C10H17N3OS — CID 102768489
2-N-(2-cyclopentyloxyethyl)-1,3-thiazole-2,5-diamine (PubChem CID 102768489) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-N-(2-cyclopentyloxyethyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(2-cyclopentyloxyethyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102768489 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-N-(2-cyclopentyloxyethyl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(NCCOC2CCCC2)s1 |
| InChI | InChI=1S/C10H17N3OS/c11-9-7-13-10(15-9)12-5-6-14-8-3-1-2-4-8/h7-8H,1-6,11H2,(H,12,13) |
| InChIKey | ULEINBZINZMPIK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|