C11H18N2OS — CID 79773903
5-(cyclopentyloxymethyl)-N-ethyl-1,3-thiazol-2-amine (PubChem CID 79773903) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 5-(cyclopentyloxymethyl)-N-ethyl-1,3-thiazol-2-amine.
| Compound Name | 5-(cyclopentyloxymethyl)-N-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79773903 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-(cyclopentyloxymethyl)-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(COC2CCCC2)s1 |
| InChI | InChI=1S/C11H18N2OS/c1-2-12-11-13-7-10(15-11)8-14-9-5-3-4-6-9/h7,9H,2-6,8H2,1H3,(H,12,13) |
| InChIKey | MJBXTDYMCSSYCE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |