C13H14N2O3S — CID 79775055
5-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-1,3-thiazol-2-amine (PubChem CID 79775055) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-1,3-thiazol-2-amine.
| Compound Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79775055 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(COc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C13H14N2O3S/c1-2-14-13-15-6-10(19-13)7-16-9-3-4-11-12(5-9)18-8-17-11/h3-6H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | ZIJWJNZTHNJHAQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |