C12H12Br2N2OS — CID 79774037
5-[(2,4-dibromophenoxy)methyl]-N-ethyl-1,3-thiazol-2-amine (PubChem CID 79774037) has the molecular formula C12H12Br2N2OS and a molecular weight of 392.12 g/mol. Its IUPAC name is 5-[(2,4-dibromophenoxy)methyl]-N-ethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(2,4-dibromophenoxy)methyl]-N-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774037 |
| Molecular Formula | C12H12Br2N2OS |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 389.90 |
| IUPAC Name | 5-[(2,4-dibromophenoxy)methyl]-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(COc2ccc(Br)cc2Br)s1 |
| InChI | InChI=1S/C12H12Br2N2OS/c1-2-15-12-16-6-9(18-12)7-17-11-4-3-8(13)5-10(11)14/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | XSQPQRXXEHXAMN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |