C12H11Br2N3O3S — CID 79761181
5-[(2,6-dibromo-4-nitrophenoxy)methyl]-N-ethyl-1,3-thiazol-2-amine (PubChem CID 79761181) has the molecular formula C12H11Br2N3O3S and a molecular weight of 437.11 g/mol. Its IUPAC name is 5-[(2,6-dibromo-4-nitrophenoxy)methyl]-N-ethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(2,6-dibromo-4-nitrophenoxy)methyl]-N-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79761181 |
| Molecular Formula | C12H11Br2N3O3S |
| Molecular Weight | 437.11 g/mol |
| Exact Mass | 434.89 |
| IUPAC Name | 5-[(2,6-dibromo-4-nitrophenoxy)methyl]-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(COc2c(Br)cc([N+](=O)[O-])cc2Br)s1 |
| InChI | InChI=1S/C12H11Br2N3O3S/c1-2-15-12-16-5-8(21-12)6-20-11-9(13)3-7(17(18)19)4-10(11)14/h3-5H,2,6H2,1H3,(H,15,16) |
| InChIKey | CLZDZCRIWWRROF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.11 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|