C13H14ClN3O3S — CID 79761294
5-[(2-chloro-4-nitrophenoxy)methyl]-N-propyl-1,3-thiazol-2-amine (PubChem CID 79761294) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenoxy)methyl]-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79761294 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1ncc(COc2ccc([N+](=O)[O-])cc2Cl)s1 |
| InChI | InChI=1S/C13H14ClN3O3S/c1-2-5-15-13-16-7-10(21-13)8-20-12-4-3-9(17(18)19)6-11(12)14/h3-4,6-7H,2,5,8H2,1H3,(H,15,16) |
| InChIKey | WWZRKTPZSMMMCB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|