C10H6Cl2N2O3S — CID 79764621
2-chloro-5-[(2-chloro-5-nitrophenoxy)methyl]-1,3-thiazole (PubChem CID 79764621) has the molecular formula C10H6Cl2N2O3S and a molecular weight of 305.14 g/mol. Its IUPAC name is 2-chloro-5-[(2-chloro-5-nitrophenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[(2-chloro-5-nitrophenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79764621 |
| Molecular Formula | C10H6Cl2N2O3S |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | 2-chloro-5-[(2-chloro-5-nitrophenoxy)methyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(OCc2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C10H6Cl2N2O3S/c11-8-2-1-6(14(15)16)3-9(8)17-5-7-4-13-10(12)18-7/h1-4H,5H2 |
| InChIKey | JQTYSRCPBUYIBV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|