C10H10N4O3S — CID 79764786
[5-[(4-nitrophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764786) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is [5-[(4-nitrophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(4-nitrophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764786 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | [5-[(4-nitrophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(COc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C10H10N4O3S/c11-13-10-12-5-9(18-10)6-17-8-3-1-7(2-4-8)14(15)16/h1-5H,6,11H2,(H,12,13) |
| InChIKey | BLUGVXVKAYWQHU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|