C10H10N4O2S2 — CID 79764045
[5-[(2-nitrophenyl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764045) has the molecular formula C10H10N4O2S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is [5-[(2-nitrophenyl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(2-nitrophenyl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764045 |
| Molecular Formula | C10H10N4O2S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | [5-[(2-nitrophenyl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(CSc2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H10N4O2S2/c11-13-10-12-5-7(18-10)6-17-9-4-2-1-3-8(9)14(15)16/h1-5H,6,11H2,(H,12,13) |
| InChIKey | KZYMCTAWXMJGAP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|