C10H9BrN4O3S — CID 103589477
[5-[(3-bromo-5-nitrophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 103589477) has the molecular formula C10H9BrN4O3S and a molecular weight of 345.18 g/mol. Its IUPAC name is [5-[(3-bromo-5-nitrophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(3-bromo-5-nitrophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 103589477 |
| Molecular Formula | C10H9BrN4O3S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | [5-[(3-bromo-5-nitrophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(COc2cc(Br)cc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C10H9BrN4O3S/c11-6-1-7(15(16)17)3-8(2-6)18-5-9-4-13-10(14-12)19-9/h1-4H,5,12H2,(H,13,14) |
| InChIKey | KLRRPGGKMFNUKI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|