C10H10IN3OS — CID 79763915
[5-[(4-iodophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79763915) has the molecular formula C10H10IN3OS and a molecular weight of 347.18 g/mol. Its IUPAC name is [5-[(4-iodophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(4-iodophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79763915 |
| Molecular Formula | C10H10IN3OS |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | [5-[(4-iodophenoxy)methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(COc2ccc(I)cc2)s1 |
| InChI | InChI=1S/C10H10IN3OS/c11-7-1-3-8(4-2-7)15-6-9-5-13-10(14-12)16-9/h1-5H,6,12H2,(H,13,14) |
| InChIKey | CYXVFCSEVBXFDD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|