C12H15N3OS — CID 79764668
[5-[(2,5-dimethylphenoxy)methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764668) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is [5-[(2,5-dimethylphenoxy)methyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(2,5-dimethylphenoxy)methyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764668 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [5-[(2,5-dimethylphenoxy)methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1ccc(C)c(OCc2cnc(NN)s2)c1 |
| InChI | InChI=1S/C12H15N3OS/c1-8-3-4-9(2)11(5-8)16-7-10-6-14-12(15-13)17-10/h3-6H,7,13H2,1-2H3,(H,14,15) |
| InChIKey | ORKAMGJIKQHELF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|