C11H10Cl2N4O3S — CID 80602257
5-[(2,6-dichloro-4-nitrophenoxy)methyl]-N-ethyl-1,3,4-thiadiazol-2-amine (PubChem CID 80602257) has the molecular formula C11H10Cl2N4O3S and a molecular weight of 349.20 g/mol. Its IUPAC name is 5-[(2,6-dichloro-4-nitrophenoxy)methyl]-N-ethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(2,6-dichloro-4-nitrophenoxy)methyl]-N-ethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80602257 |
| Molecular Formula | C11H10Cl2N4O3S |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 5-[(2,6-dichloro-4-nitrophenoxy)methyl]-N-ethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(COc2c(Cl)cc([N+](=O)[O-])cc2Cl)s1 |
| InChI | InChI=1S/C11H10Cl2N4O3S/c1-2-14-11-16-15-9(21-11)5-20-10-7(12)3-6(17(18)19)4-8(10)13/h3-4H,2,5H2,1H3,(H,14,16) |
| InChIKey | FSFFMMLICGFBSR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|