C11H12N4O3S — CID 80608036
N-ethyl-5-[(3-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 80608036) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is N-ethyl-5-[(3-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-ethyl-5-[(3-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80608036 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-ethyl-5-[(3-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(COc2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C11H12N4O3S/c1-2-12-11-14-13-10(19-11)7-18-9-5-3-4-8(6-9)15(16)17/h3-6H,2,7H2,1H3,(H,12,14) |
| InChIKey | DIKFFHVIGSWUED-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|