C10H11N5O4S — CID 103202266
[5-[(4-methoxy-3-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 103202266) has the molecular formula C10H11N5O4S and a molecular weight of 297.30 g/mol. Its IUPAC name is [5-[(4-methoxy-3-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(4-methoxy-3-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 103202266 |
| Molecular Formula | C10H11N5O4S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | [5-[(4-methoxy-3-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | COc1ccc(OCc2nnc(NN)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O4S/c1-18-8-3-2-6(4-7(8)15(16)17)19-5-9-13-14-10(12-11)20-9/h2-4H,5,11H2,1H3,(H,12,14) |
| InChIKey | JBYMUUWWJQMXAB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|