C10H10BrN5O3S — CID 80614326
[5-[(4-bromo-2-methyl-6-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80614326) has the molecular formula C10H10BrN5O3S and a molecular weight of 360.19 g/mol. Its IUPAC name is [5-[(4-bromo-2-methyl-6-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(4-bromo-2-methyl-6-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80614326 |
| Molecular Formula | C10H10BrN5O3S |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | [5-[(4-bromo-2-methyl-6-nitrophenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | Cc1cc(Br)cc([N+](=O)[O-])c1OCc1nnc(NN)s1 |
| InChI | InChI=1S/C10H10BrN5O3S/c1-5-2-6(11)3-7(16(17)18)9(5)19-4-8-14-15-10(13-12)20-8/h2-3H,4,12H2,1H3,(H,13,15) |
| InChIKey | XFKHEUBTVZYRJL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|