C11H13ClN4OS — CID 80613611
[5-[(4-chloro-3-ethylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80613611) has the molecular formula C11H13ClN4OS and a molecular weight of 284.77 g/mol. Its IUPAC name is [5-[(4-chloro-3-ethylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(4-chloro-3-ethylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80613611 |
| Molecular Formula | C11H13ClN4OS |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | [5-[(4-chloro-3-ethylphenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | CCc1cc(OCc2nnc(NN)s2)ccc1Cl |
| InChI | InChI=1S/C11H13ClN4OS/c1-2-7-5-8(3-4-9(7)12)17-6-10-15-16-11(14-13)18-10/h3-5H,2,6,13H2,1H3,(H,14,16) |
| InChIKey | IHXHKCWUDDGROT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|