C11H14N4O2S — CID 80614512
[5-[(4-ethoxyphenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80614512) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is [5-[(4-ethoxyphenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(4-ethoxyphenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80614512 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | [5-[(4-ethoxyphenoxy)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | CCOc1ccc(OCc2nnc(NN)s2)cc1 |
| InChI | InChI=1S/C11H14N4O2S/c1-2-16-8-3-5-9(6-4-8)17-7-10-14-15-11(13-12)18-10/h3-6H,2,7,12H2,1H3,(H,13,15) |
| InChIKey | NCAKSEKTDAUDDP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|