C12H16N4OS — CID 98017566
5-(2-aminoethyl)-N-(4-ethoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 98017566) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(4-ethoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-aminoethyl)-N-(4-ethoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 98017566 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5-(2-aminoethyl)-N-(4-ethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCOc1ccc(Nc2nnc(CCN)s2)cc1 |
| InChI | InChI=1S/C12H16N4OS/c1-2-17-10-5-3-9(4-6-10)14-12-16-15-11(18-12)7-8-13/h3-6H,2,7-8,13H2,1H3,(H,14,16) |
| InChIKey | GVRLKIPTKIRCBP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |