C11H14N4OS — CID 96663796
5-(aminomethyl)-N-(2-ethoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 96663796) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-ethoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(aminomethyl)-N-(2-ethoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 96663796 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 5-(aminomethyl)-N-(2-ethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCOc1ccccc1Nc1nnc(CN)s1 |
| InChI | InChI=1S/C11H14N4OS/c1-2-16-9-6-4-3-5-8(9)13-11-15-14-10(7-12)17-11/h3-6H,2,7,12H2,1H3,(H,13,15) |
| InChIKey | CASYXBGILQRFMM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |